C23H22ClNO4 — CID 7936748
2-(2-benzylphenoxy)-N-(4-chloro-2,5-dimethoxyphenyl)acetamide (PubChem CID 7936748) has the molecular formula C23H22ClNO4 and a molecular weight of 411.89 g/mol. Its IUPAC name is 2-(2-benzylphenoxy)-N-(4-chloro-2,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-(2-benzylphenoxy)-N-(4-chloro-2,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 7936748 |
| Molecular Formula | C23H22ClNO4 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 2-(2-benzylphenoxy)-N-(4-chloro-2,5-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)COc2ccccc2Cc2ccccc2)c(OC)cc1Cl |
| InChI | InChI=1S/C23H22ClNO4/c1-27-21-14-19(22(28-2)13-18(21)24)25-23(26)15-29-20-11-7-6-10-17(20)12-16-8-4-3-5-9-16/h3-11,13-14H,12,15H2,1-2H3,(H,25,26) |
| InChIKey | USQQDSXWBWPUEQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |