About 5-methoxyspiro[1,2-dihydroindene-3,2'-oxane]-4'-amine
5-methoxyspiro[1,2-dihydroindene-3,2'-oxane]-4'-amine (PubChem CID 79368374) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is 5-methoxyspiro[1,2-dihydroindene-3,2'-oxane]-4'-amine.
Molecular Properties
| Compound Name | 5-methoxyspiro[1,2-dihydroindene-3,2'-oxane]-4'-amine |
| PubChem CID | 79368374 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 5-methoxyspiro[1,2-dihydroindene-3,2'-oxane]-4'-amine |
| SMILES | COc1ccc2c(c1)C1(CC2)CC(N)CCO1 |
| InChI | InChI=1S/C14H19NO2/c1-16-12-3-2-10-4-6-14(13(10)8-12)9-11(15)5-7-17-14/h2-3,8,11H,4-7,9,15H2,1H3 |
| InChIKey | LVPGWDFAJJFKAN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxyspiro[1,2-dihydroindene-3,2'-oxane]-4'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxyspiro[1,2-dihydroindene-3,2'-oxane]-4'-amine?
The IUPAC name of 5-methoxyspiro[1,2-dihydroindene-3,2'-oxane]-4'-amine (CID 79368374) is 5-methoxyspiro[1,2-dihydroindene-3,2'-oxane]-4'-amine.
What is the SMILES notation for 5-methoxyspiro[1,2-dihydroindene-3,2'-oxane]-4'-amine?
The canonical SMILES for 5-methoxyspiro[1,2-dihydroindene-3,2'-oxane]-4'-amine is COc1ccc2c(c1)C1(CC2)CC(N)CCO1.
What is the InChIKey of 5-methoxyspiro[1,2-dihydroindene-3,2'-oxane]-4'-amine?
The InChIKey is LVPGWDFAJJFKAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c1-16-12-3-2-10-4-6-14(13(10)8-12)9-11(15)5-7-17-14/h2-3,8,11H,4-7,9,15H2,1H3.
What are the key properties of 5-methoxyspiro[1,2-dihydroindene-3,2'-oxane]-4'-amine?
5-methoxyspiro[1,2-dihydroindene-3,2'-oxane]-4'-amine has a molecular weight of 233.31 g/mol, XLogP of 1.97, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxyspiro[1,2-dihydroindene-3,2'-oxane]-4'-amine is sourced from PubChem (CID 79368374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).