C12H11IN2OS — CID 79375577
1-[5-(4-iodoanilino)-3-methyl-1,2-thiazol-4-yl]ethanone (PubChem CID 79375577) has the molecular formula C12H11IN2OS and a molecular weight of 358.20 g/mol. Its IUPAC name is 1-[5-(4-iodoanilino)-3-methyl-1,2-thiazol-4-yl]ethanone.
| Compound Name | 1-[5-(4-iodoanilino)-3-methyl-1,2-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 79375577 |
| Molecular Formula | C12H11IN2OS |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 1-[5-(4-iodoanilino)-3-methyl-1,2-thiazol-4-yl]ethanone |
| SMILES | CC(=O)c1c(C)nsc1Nc1ccc(I)cc1 |
| InChI | InChI=1S/C12H11IN2OS/c1-7-11(8(2)16)12(17-15-7)14-10-5-3-9(13)4-6-10/h3-6,14H,1-2H3 |
| InChIKey | HRTCUWNDJYEKMV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|