C15H20ClF3N2O3S — CID 7937672
N-tert-butyl-2-[[4-chloro-2-(trifluoromethyl)phenyl]sulfonyl-ethylamino]acetamide (PubChem CID 7937672) has the molecular formula C15H20ClF3N2O3S and a molecular weight of 400.85 g/mol. Its IUPAC name is N-tert-butyl-2-[[4-chloro-2-(trifluoromethyl)phenyl]sulfonyl-ethylamino]acetamide.
| Compound Name | N-tert-butyl-2-[[4-chloro-2-(trifluoromethyl)phenyl]sulfonyl-ethylamino]acetamide |
|---|---|
| PubChem CID | 7937672 |
| Molecular Formula | C15H20ClF3N2O3S |
| Molecular Weight | 400.85 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | N-tert-butyl-2-[[4-chloro-2-(trifluoromethyl)phenyl]sulfonyl-ethylamino]acetamide |
| SMILES | CCN(CC(=O)NC(C)(C)C)S(=O)(=O)c1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C15H20ClF3N2O3S/c1-5-21(9-13(22)20-14(2,3)4)25(23,24)12-7-6-10(16)8-11(12)15(17,18)19/h6-8H,5,9H2,1-4H3,(H,20,22) |
| InChIKey | ZDEDQTPZXOWFPX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.85 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |