C14H23N3O4 — CID 79381622
1-[[4-(cyclopropylamino)-4-oxobutyl]carbamoyl]piperidine-3-carboxylic acid (PubChem CID 79381622) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is 1-[[4-(cyclopropylamino)-4-oxobutyl]carbamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[[4-(cyclopropylamino)-4-oxobutyl]carbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 79381622 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-[[4-(cyclopropylamino)-4-oxobutyl]carbamoyl]piperidine-3-carboxylic acid |
| SMILES | O=C(CCCNC(=O)N1CCCC(C(=O)O)C1)NC1CC1 |
| InChI | InChI=1S/C14H23N3O4/c18-12(16-11-5-6-11)4-1-7-15-14(21)17-8-2-3-10(9-17)13(19)20/h10-11H,1-9H2,(H,15,21)(H,16,18)(H,19,20) |
| InChIKey | IVXDAFNOAAXAQW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|