C14H16F3NO — CID 79396754
2,3-dimethyl-1-[3-(trifluoromethyl)phenyl]piperidin-4-one (PubChem CID 79396754) has the molecular formula C14H16F3NO and a molecular weight of 271.28 g/mol. Its IUPAC name is 2,3-dimethyl-1-[3-(trifluoromethyl)phenyl]piperidin-4-one.
| Compound Name | 2,3-dimethyl-1-[3-(trifluoromethyl)phenyl]piperidin-4-one |
|---|---|
| PubChem CID | 79396754 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2,3-dimethyl-1-[3-(trifluoromethyl)phenyl]piperidin-4-one |
| SMILES | CC1C(=O)CCN(c2cccc(C(F)(F)F)c2)C1C |
| InChI | InChI=1S/C14H16F3NO/c1-9-10(2)18(7-6-13(9)19)12-5-3-4-11(8-12)14(15,16)17/h3-5,8-10H,6-7H2,1-2H3 |
| InChIKey | LCXIACUOOIPTDU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |