C10H19N3 — CID 79409202
N,2-dimethyl-3-(2-methylimidazol-1-yl)butan-1-amine (PubChem CID 79409202) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is N,2-dimethyl-3-(2-methylimidazol-1-yl)butan-1-amine.
| Compound Name | N,2-dimethyl-3-(2-methylimidazol-1-yl)butan-1-amine |
|---|---|
| PubChem CID | 79409202 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | N,2-dimethyl-3-(2-methylimidazol-1-yl)butan-1-amine |
| SMILES | CNCC(C)C(C)n1ccnc1C |
| InChI | InChI=1S/C10H19N3/c1-8(7-11-4)9(2)13-6-5-12-10(13)3/h5-6,8-9,11H,7H2,1-4H3 |
| InChIKey | LOHCRGVSTTULBP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |