C14H25N3 — CID 79412272
2-(2-butyl-4,6-dimethylpyrimidin-5-yl)-N-ethylethanamine (PubChem CID 79412272) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-(2-butyl-4,6-dimethylpyrimidin-5-yl)-N-ethylethanamine.
| Compound Name | 2-(2-butyl-4,6-dimethylpyrimidin-5-yl)-N-ethylethanamine |
|---|---|
| PubChem CID | 79412272 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 2-(2-butyl-4,6-dimethylpyrimidin-5-yl)-N-ethylethanamine |
| SMILES | CCCCc1nc(C)c(CCNCC)c(C)n1 |
| InChI | InChI=1S/C14H25N3/c1-5-7-8-14-16-11(3)13(12(4)17-14)9-10-15-6-2/h15H,5-10H2,1-4H3 |
| InChIKey | UQHWDIUQKXUSFE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|