C12H24N2O2 — CID 79414421
3-[2-(aminomethyl)-3-methylpiperidin-1-yl]-2-methylbutanoic acid (PubChem CID 79414421) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 3-[2-(aminomethyl)-3-methylpiperidin-1-yl]-2-methylbutanoic acid.
| Compound Name | 3-[2-(aminomethyl)-3-methylpiperidin-1-yl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 79414421 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 3-[2-(aminomethyl)-3-methylpiperidin-1-yl]-2-methylbutanoic acid |
| SMILES | CC1CCCN(C(C)C(C)C(=O)O)C1CN |
| InChI | InChI=1S/C12H24N2O2/c1-8-5-4-6-14(11(8)7-13)10(3)9(2)12(15)16/h8-11H,4-7,13H2,1-3H3,(H,15,16) |
| InChIKey | FLZXGYREGVLWPK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |