C14H21NO — CID 79423318
4-methyl-2-(2-pyridin-2-ylethyl)cyclohexan-1-ol (PubChem CID 79423318) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 4-methyl-2-(2-pyridin-2-ylethyl)cyclohexan-1-ol.
| Compound Name | 4-methyl-2-(2-pyridin-2-ylethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 79423318 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 4-methyl-2-(2-pyridin-2-ylethyl)cyclohexan-1-ol |
| SMILES | CC1CCC(O)C(CCc2ccccn2)C1 |
| InChI | InChI=1S/C14H21NO/c1-11-5-8-14(16)12(10-11)6-7-13-4-2-3-9-15-13/h2-4,9,11-12,14,16H,5-8,10H2,1H3 |
| InChIKey | QYKNFMXGHDRJEJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |