C9H20O3 — CID 79423603
1-ethoxy-4-methylhexane-2,5-diol (PubChem CID 79423603) has the molecular formula C9H20O3 and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-ethoxy-4-methylhexane-2,5-diol.
| Compound Name | 1-ethoxy-4-methylhexane-2,5-diol |
|---|---|
| PubChem CID | 79423603 |
| Molecular Formula | C9H20O3 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | 1-ethoxy-4-methylhexane-2,5-diol |
| SMILES | CCOCC(O)CC(C)C(C)O |
| InChI | InChI=1S/C9H20O3/c1-4-12-6-9(11)5-7(2)8(3)10/h7-11H,4-6H2,1-3H3 |
| InChIKey | JCEJWDOHKMTSJR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |