C11H18O5S — CID 79426177
2-(1,1-dioxothiolan-3-yl)-2-(oxan-4-yl)acetic acid (PubChem CID 79426177) has the molecular formula C11H18O5S and a molecular weight of 262.33 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-2-(oxan-4-yl)acetic acid.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-2-(oxan-4-yl)acetic acid |
|---|---|
| PubChem CID | 79426177 |
| Molecular Formula | C11H18O5S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-2-(oxan-4-yl)acetic acid |
| SMILES | O=C(O)C(C1CCOCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H18O5S/c12-11(13)10(8-1-4-16-5-2-8)9-3-6-17(14,15)7-9/h8-10H,1-7H2,(H,12,13) |
| InChIKey | FXXNUTYUBNPZAE-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |