C10H16O5S — CID 63013988
3-(1,1-dioxothiolan-3-yl)oxane-3-carboxylic acid (PubChem CID 63013988) has the molecular formula C10H16O5S and a molecular weight of 248.30 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)oxane-3-carboxylic acid.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)oxane-3-carboxylic acid |
|---|---|
| PubChem CID | 63013988 |
| Molecular Formula | C10H16O5S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)oxane-3-carboxylic acid |
| SMILES | O=C(O)C1(C2CCS(=O)(=O)C2)CCCOC1 |
| InChI | InChI=1S/C10H16O5S/c11-9(12)10(3-1-4-15-7-10)8-2-5-16(13,14)6-8/h8H,1-7H2,(H,11,12) |
| InChIKey | UNSFSUPYRMTKPJ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |