2-(1,1-dioxothiolan-3-yl)-5-(2-methoxyethoxy)pentanoic acid

C12H22O6S — CID 103410969

IUPAC2-(1,1-dioxothiolan-3-yl)-5-(2-methoxyethoxy)pentanoic acid
SMILESCOCCOCCCC(C(=O)O)C1CCS(=O)(=O)C1
InChIInChI=1S/C12H22O6S/c1-17-6-7-18-5-2-3-11(12(13)14)10-4-8-19(15,16)9-10/h10-11H,2-9H2,1H3,(H,13,14)
InChIKeySGWQTHFZZAFMKP-UHFFFAOYSA-N
MW294.37 g/mol
LogP0.57
Rot. Bonds9

About 2-(1,1-dioxothiolan-3-yl)-5-(2-methoxyethoxy)pentanoic acid

2-(1,1-dioxothiolan-3-yl)-5-(2-methoxyethoxy)pentanoic acid (PubChem CID 103410969) has the molecular formula C12H22O6S and a molecular weight of 294.37 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-5-(2-methoxyethoxy)pentanoic acid.

Molecular Properties

Compound Name2-(1,1-dioxothiolan-3-yl)-5-(2-methoxyethoxy)pentanoic acid
PubChem CID103410969
Molecular FormulaC12H22O6S
Molecular Weight294.37 g/mol
Exact Mass294.11
IUPAC Name2-(1,1-dioxothiolan-3-yl)-5-(2-methoxyethoxy)pentanoic acid
SMILESCOCCOCCCC(C(=O)O)C1CCS(=O)(=O)C1
InChIInChI=1S/C12H22O6S/c1-17-6-7-18-5-2-3-11(12(13)14)10-4-8-19(15,16)9-10/h10-11H,2-9H2,1H3,(H,13,14)
InChIKeySGWQTHFZZAFMKP-UHFFFAOYSA-N
XLogP0.57
TPSA89.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.37
LogP ≤ 50.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(1,1-dioxothiolan-3-yl)-5-(2-methoxyethoxy)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,1-dioxothiolan-3-yl)-5-(2-methoxyethoxy)pentanoic acid?
The IUPAC name of 2-(1,1-dioxothiolan-3-yl)-5-(2-methoxyethoxy)pentanoic acid (CID 103410969) is 2-(1,1-dioxothiolan-3-yl)-5-(2-methoxyethoxy)pentanoic acid.
What is the SMILES notation for 2-(1,1-dioxothiolan-3-yl)-5-(2-methoxyethoxy)pentanoic acid?
The canonical SMILES for 2-(1,1-dioxothiolan-3-yl)-5-(2-methoxyethoxy)pentanoic acid is COCCOCCCC(C(=O)O)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-(1,1-dioxothiolan-3-yl)-5-(2-methoxyethoxy)pentanoic acid?
The InChIKey is SGWQTHFZZAFMKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O6S/c1-17-6-7-18-5-2-3-11(12(13)14)10-4-8-19(15,16)9-10/h10-11H,2-9H2,1H3,(H,13,14).
What are the key properties of 2-(1,1-dioxothiolan-3-yl)-5-(2-methoxyethoxy)pentanoic acid?
2-(1,1-dioxothiolan-3-yl)-5-(2-methoxyethoxy)pentanoic acid has a molecular weight of 294.37 g/mol, XLogP of 0.57, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothiolan-3-yl)-5-(2-methoxyethoxy)pentanoic acid is sourced from PubChem (CID 103410969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).