C10H16O6S — CID 103719489
3-(4-hydroxy-1,1-dioxothiolan-3-yl)oxane-3-carboxylic acid (PubChem CID 103719489) has the molecular formula C10H16O6S and a molecular weight of 264.30 g/mol. Its IUPAC name is 3-(4-hydroxy-1,1-dioxothiolan-3-yl)oxane-3-carboxylic acid.
| Compound Name | 3-(4-hydroxy-1,1-dioxothiolan-3-yl)oxane-3-carboxylic acid |
|---|---|
| PubChem CID | 103719489 |
| Molecular Formula | C10H16O6S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 3-(4-hydroxy-1,1-dioxothiolan-3-yl)oxane-3-carboxylic acid |
| SMILES | O=C(O)C1(C2CS(=O)(=O)CC2O)CCCOC1 |
| InChI | InChI=1S/C10H16O6S/c11-8-5-17(14,15)4-7(8)10(9(12)13)2-1-3-16-6-10/h7-8,11H,1-6H2,(H,12,13) |
| InChIKey | WFUPSJVARHDNHT-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |