C12H20O7S — CID 103973444
2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-5-hydroxypentanoic acid (PubChem CID 103973444) has the molecular formula C12H20O7S and a molecular weight of 308.35 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-5-hydroxypentanoic acid.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-5-hydroxypentanoic acid |
|---|---|
| PubChem CID | 103973444 |
| Molecular Formula | C12H20O7S |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-5-hydroxypentanoic acid |
| SMILES | CCOC(=O)C(CCCO)(C(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H20O7S/c1-2-19-11(16)12(10(14)15,5-3-6-13)9-4-7-20(17,18)8-9/h9,13H,2-8H2,1H3,(H,14,15) |
| InChIKey | FHPRTBVAUHVMQY-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|