C13H22O7S — CID 103972993
diethyl 2-ethyl-2-(4-hydroxy-1,1-dioxothiolan-3-yl)propanedioate (PubChem CID 103972993) has the molecular formula C13H22O7S and a molecular weight of 322.38 g/mol. Its IUPAC name is diethyl 2-ethyl-2-(4-hydroxy-1,1-dioxothiolan-3-yl)propanedioate.
| Compound Name | diethyl 2-ethyl-2-(4-hydroxy-1,1-dioxothiolan-3-yl)propanedioate |
|---|---|
| PubChem CID | 103972993 |
| Molecular Formula | C13H22O7S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | diethyl 2-ethyl-2-(4-hydroxy-1,1-dioxothiolan-3-yl)propanedioate |
| SMILES | CCOC(=O)C(CC)(C(=O)OCC)C1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C13H22O7S/c1-4-13(11(15)19-5-2,12(16)20-6-3)9-7-21(17,18)8-10(9)14/h9-10,14H,4-8H2,1-3H3 |
| InChIKey | HTBFMTQCEUYKLV-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|