C12H20O8S — CID 103973453
2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4,5-dihydroxypentanoic acid (PubChem CID 103973453) has the molecular formula C12H20O8S and a molecular weight of 324.35 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4,5-dihydroxypentanoic acid.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4,5-dihydroxypentanoic acid |
|---|---|
| PubChem CID | 103973453 |
| Molecular Formula | C12H20O8S |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4,5-dihydroxypentanoic acid |
| SMILES | CCOC(=O)C(CC(O)CO)(C(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H20O8S/c1-2-20-11(17)12(10(15)16,5-9(14)6-13)8-3-4-21(18,19)7-8/h8-9,13-14H,2-7H2,1H3,(H,15,16) |
| InChIKey | BVOMAGVZUTZKPW-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|