C13H20O7S — CID 103973447
2-(1,1-dioxothiolan-3-yl)-3-ethoxy-3-oxo-2-(oxolan-3-yl)propanoic acid (PubChem CID 103973447) has the molecular formula C13H20O7S and a molecular weight of 320.36 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-3-ethoxy-3-oxo-2-(oxolan-3-yl)propanoic acid.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-3-ethoxy-3-oxo-2-(oxolan-3-yl)propanoic acid |
|---|---|
| PubChem CID | 103973447 |
| Molecular Formula | C13H20O7S |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-3-ethoxy-3-oxo-2-(oxolan-3-yl)propanoic acid |
| SMILES | CCOC(=O)C(C(=O)O)(C1CCOC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H20O7S/c1-2-20-12(16)13(11(14)15,9-3-5-19-7-9)10-4-6-21(17,18)8-10/h9-10H,2-8H2,1H3,(H,14,15) |
| InChIKey | OIPKWKXNOKQKGT-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|