C12H20O6S — CID 103973442
2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-3-methylbutanoic acid (PubChem CID 103973442) has the molecular formula C12H20O6S and a molecular weight of 292.35 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-3-methylbutanoic acid.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 103973442 |
| Molecular Formula | C12H20O6S |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-3-methylbutanoic acid |
| SMILES | CCOC(=O)C(C(=O)O)(C(C)C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H20O6S/c1-4-18-11(15)12(8(2)3,10(13)14)9-5-6-19(16,17)7-9/h8-9H,4-7H2,1-3H3,(H,13,14) |
| InChIKey | HQCYWKGMABVTLT-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|