C13H22O6S — CID 103973441
2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4-methylpentanoic acid (PubChem CID 103973441) has the molecular formula C13H22O6S and a molecular weight of 306.38 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4-methylpentanoic acid.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4-methylpentanoic acid |
|---|---|
| PubChem CID | 103973441 |
| Molecular Formula | C13H22O6S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4-methylpentanoic acid |
| SMILES | CCOC(=O)C(CC(C)C)(C(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H22O6S/c1-4-19-12(16)13(11(14)15,7-9(2)3)10-5-6-20(17,18)8-10/h9-10H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | LWYKZTXZWYWSNR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|