C12H20O7S — CID 103972549
diethyl 2-(4-hydroxy-1,1-dioxothiolan-3-yl)-2-methylpropanedioate (PubChem CID 103972549) has the molecular formula C12H20O7S and a molecular weight of 308.35 g/mol. Its IUPAC name is diethyl 2-(4-hydroxy-1,1-dioxothiolan-3-yl)-2-methylpropanedioate.
| Compound Name | diethyl 2-(4-hydroxy-1,1-dioxothiolan-3-yl)-2-methylpropanedioate |
|---|---|
| PubChem CID | 103972549 |
| Molecular Formula | C12H20O7S |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | diethyl 2-(4-hydroxy-1,1-dioxothiolan-3-yl)-2-methylpropanedioate |
| SMILES | CCOC(=O)C(C)(C(=O)OCC)C1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C12H20O7S/c1-4-18-10(14)12(3,11(15)19-5-2)8-6-20(16,17)7-9(8)13/h8-9,13H,4-7H2,1-3H3 |
| InChIKey | LGRNALPLYOMSOZ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|