C11H18O6S — CID 7061466
diethyl 2-[(3S)-1,1-dioxothiolan-3-yl]propanedioate (PubChem CID 7061466) has the molecular formula C11H18O6S and a molecular weight of 278.33 g/mol. Its IUPAC name is diethyl 2-[(3S)-1,1-dioxothiolan-3-yl]propanedioate.
| Compound Name | diethyl 2-[(3S)-1,1-dioxothiolan-3-yl]propanedioate |
|---|---|
| PubChem CID | 7061466 |
| Molecular Formula | C11H18O6S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | diethyl 2-[(3S)-1,1-dioxothiolan-3-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H18O6S/c1-3-16-10(12)9(11(13)17-4-2)8-5-6-18(14,15)7-8/h8-9H,3-7H2,1-2H3/t8-/m1/s1 |
| InChIKey | ZRZIZOUPRLJLLK-MRVPVSSYSA-N |
| XLogP | 0.16 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|