C10H16O6S — CID 6577445
1-O-ethyl 3-O-methyl (2S)-2-[(3R)-1,1-dioxothiolan-3-yl]propanedioate (PubChem CID 6577445) has the molecular formula C10H16O6S and a molecular weight of 264.30 g/mol. Its IUPAC name is 1-O-ethyl 3-O-methyl (2S)-2-[(3R)-1,1-dioxothiolan-3-yl]propanedioate.
| Compound Name | 1-O-ethyl 3-O-methyl (2S)-2-[(3R)-1,1-dioxothiolan-3-yl]propanedioate |
|---|---|
| PubChem CID | 6577445 |
| Molecular Formula | C10H16O6S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 1-O-ethyl 3-O-methyl (2S)-2-[(3R)-1,1-dioxothiolan-3-yl]propanedioate |
| SMILES | CCOC(=O)[C@H](C(=O)OC)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H16O6S/c1-3-16-10(12)8(9(11)15-2)7-4-5-17(13,14)6-7/h7-8H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | URXAXCGKSSTNHR-YUMQZZPRSA-N |
| XLogP | -0.23 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|