C18H26FN — CID 79431795
5-(3-fluorophenyl)-10,11-dimethyl-3-azaspiro[5.5]undecane (PubChem CID 79431795) has the molecular formula C18H26FN and a molecular weight of 275.41 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-10,11-dimethyl-3-azaspiro[5.5]undecane.
| Compound Name | 5-(3-fluorophenyl)-10,11-dimethyl-3-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 79431795 |
| Molecular Formula | C18H26FN |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 5-(3-fluorophenyl)-10,11-dimethyl-3-azaspiro[5.5]undecane |
| SMILES | CC1CCCC2(CCNCC2c2cccc(F)c2)C1C |
| InChI | InChI=1S/C18H26FN/c1-13-5-4-8-18(14(13)2)9-10-20-12-17(18)15-6-3-7-16(19)11-15/h3,6-7,11,13-14,17,20H,4-5,8-10,12H2,1-2H3 |
| InChIKey | FFPKPFPRZIHDMF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |