About 5-(3-fluorophenyl)-10,11-dimethyl-3-azaspiro[5.5]undecane
5-(3-fluorophenyl)-10,11-dimethyl-3-azaspiro[5.5]undecane (PubChem CID 79431795) has the molecular formula C18H26FN
and a molecular weight of 275.41 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-10,11-dimethyl-3-azaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 5-(3-fluorophenyl)-10,11-dimethyl-3-azaspiro[5.5]undecane |
| PubChem CID | 79431795 |
| Molecular Formula | C18H26FN |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 5-(3-fluorophenyl)-10,11-dimethyl-3-azaspiro[5.5]undecane |
| SMILES | CC1CCCC2(CCNCC2c2cccc(F)c2)C1C |
| InChI | InChI=1S/C18H26FN/c1-13-5-4-8-18(14(13)2)9-10-20-12-17(18)15-6-3-7-16(19)11-15/h3,6-7,11,13-14,17,20H,4-5,8-10,12H2,1-2H3 |
| InChIKey | FFPKPFPRZIHDMF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(3-fluorophenyl)-10,11-dimethyl-3-azaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-fluorophenyl)-10,11-dimethyl-3-azaspiro[5.5]undecane?
The IUPAC name of 5-(3-fluorophenyl)-10,11-dimethyl-3-azaspiro[5.5]undecane (CID 79431795) is 5-(3-fluorophenyl)-10,11-dimethyl-3-azaspiro[5.5]undecane.
What is the SMILES notation for 5-(3-fluorophenyl)-10,11-dimethyl-3-azaspiro[5.5]undecane?
The canonical SMILES for 5-(3-fluorophenyl)-10,11-dimethyl-3-azaspiro[5.5]undecane is CC1CCCC2(CCNCC2c2cccc(F)c2)C1C.
What is the InChIKey of 5-(3-fluorophenyl)-10,11-dimethyl-3-azaspiro[5.5]undecane?
The InChIKey is FFPKPFPRZIHDMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26FN/c1-13-5-4-8-18(14(13)2)9-10-20-12-17(18)15-6-3-7-16(19)11-15/h3,6-7,11,13-14,17,20H,4-5,8-10,12H2,1-2H3.
What are the key properties of 5-(3-fluorophenyl)-10,11-dimethyl-3-azaspiro[5.5]undecane?
5-(3-fluorophenyl)-10,11-dimethyl-3-azaspiro[5.5]undecane has a molecular weight of 275.41 g/mol, XLogP of 4.35, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-fluorophenyl)-10,11-dimethyl-3-azaspiro[5.5]undecane is sourced from PubChem (CID 79431795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).