C14H15FN2O2 — CID 79440857
3-(2,5-dimethylpyrazol-3-yl)-2-(3-fluorophenyl)propanoic acid (PubChem CID 79440857) has the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. Its IUPAC name is 3-(2,5-dimethylpyrazol-3-yl)-2-(3-fluorophenyl)propanoic acid.
| Compound Name | 3-(2,5-dimethylpyrazol-3-yl)-2-(3-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 79440857 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 3-(2,5-dimethylpyrazol-3-yl)-2-(3-fluorophenyl)propanoic acid |
| SMILES | Cc1cc(CC(C(=O)O)c2cccc(F)c2)n(C)n1 |
| InChI | InChI=1S/C14H15FN2O2/c1-9-6-12(17(2)16-9)8-13(14(18)19)10-4-3-5-11(15)7-10/h3-7,13H,8H2,1-2H3,(H,18,19) |
| InChIKey | BEJKKEGZZHTGRZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |