2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid

C12H10FNO3 — CID 79440093

IUPAC2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid
SMILESO=C(O)C(Cc1cnoc1)c1cccc(F)c1
InChIInChI=1S/C12H10FNO3/c13-10-3-1-2-9(5-10)11(12(15)16)4-8-6-14-17-7-8/h1-3,5-7,11H,4H2,(H,15,16)
InChIKeyLFKFFRIBLXDXQZ-UHFFFAOYSA-N
MW235.21 g/mol
LogP2.22
Rot. Bonds4

About 2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid

2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid (PubChem CID 79440093) has the molecular formula C12H10FNO3 and a molecular weight of 235.21 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid.

Molecular Properties

Compound Name2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid
PubChem CID79440093
Molecular FormulaC12H10FNO3
Molecular Weight235.21 g/mol
Exact Mass235.06
IUPAC Name2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid
SMILESO=C(O)C(Cc1cnoc1)c1cccc(F)c1
InChIInChI=1S/C12H10FNO3/c13-10-3-1-2-9(5-10)11(12(15)16)4-8-6-14-17-7-8/h1-3,5-7,11H,4H2,(H,15,16)
InChIKeyLFKFFRIBLXDXQZ-UHFFFAOYSA-N
XLogP2.22
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.21
LogP ≤ 52.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid?
The IUPAC name of 2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid (CID 79440093) is 2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid.
What is the SMILES notation for 2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid?
The canonical SMILES for 2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid is O=C(O)C(Cc1cnoc1)c1cccc(F)c1.
What is the InChIKey of 2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid?
The InChIKey is LFKFFRIBLXDXQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10FNO3/c13-10-3-1-2-9(5-10)11(12(15)16)4-8-6-14-17-7-8/h1-3,5-7,11H,4H2,(H,15,16).
What are the key properties of 2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid?
2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid has a molecular weight of 235.21 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid is sourced from PubChem (CID 79440093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).