C12H10FNO3 — CID 79440093
2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid (PubChem CID 79440093) has the molecular formula C12H10FNO3 and a molecular weight of 235.21 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid.
| Compound Name | 2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 79440093 |
| Molecular Formula | C12H10FNO3 |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-(3-fluorophenyl)-3-(1,2-oxazol-4-yl)propanoic acid |
| SMILES | O=C(O)C(Cc1cnoc1)c1cccc(F)c1 |
| InChI | InChI=1S/C12H10FNO3/c13-10-3-1-2-9(5-10)11(12(15)16)4-8-6-14-17-7-8/h1-3,5-7,11H,4H2,(H,15,16) |
| InChIKey | LFKFFRIBLXDXQZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |