C11H17Cl2NS — CID 79447024
4-[2,2-bis(chloromethyl)-4-methylpentyl]-1,3-thiazole (PubChem CID 79447024) has the molecular formula C11H17Cl2NS and a molecular weight of 266.24 g/mol. Its IUPAC name is 4-[2,2-bis(chloromethyl)-4-methylpentyl]-1,3-thiazole.
| Compound Name | 4-[2,2-bis(chloromethyl)-4-methylpentyl]-1,3-thiazole |
|---|---|
| PubChem CID | 79447024 |
| Molecular Formula | C11H17Cl2NS |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 4-[2,2-bis(chloromethyl)-4-methylpentyl]-1,3-thiazole |
| SMILES | CC(C)CC(CCl)(CCl)Cc1cscn1 |
| InChI | InChI=1S/C11H17Cl2NS/c1-9(2)3-11(6-12,7-13)4-10-5-15-8-14-10/h5,8-9H,3-4,6-7H2,1-2H3 |
| InChIKey | QUQIDIOIPANTQB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|