C13H18Cl3N — CID 79448044
4-[2,2-bis(chloromethyl)-4-methylpentyl]-3-chloropyridine (PubChem CID 79448044) has the molecular formula C13H18Cl3N and a molecular weight of 294.65 g/mol. Its IUPAC name is 4-[2,2-bis(chloromethyl)-4-methylpentyl]-3-chloropyridine.
| Compound Name | 4-[2,2-bis(chloromethyl)-4-methylpentyl]-3-chloropyridine |
|---|---|
| PubChem CID | 79448044 |
| Molecular Formula | C13H18Cl3N |
| Molecular Weight | 294.65 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 4-[2,2-bis(chloromethyl)-4-methylpentyl]-3-chloropyridine |
| SMILES | CC(C)CC(CCl)(CCl)Cc1ccncc1Cl |
| InChI | InChI=1S/C13H18Cl3N/c1-10(2)5-13(8-14,9-15)6-11-3-4-17-7-12(11)16/h3-4,7,10H,5-6,8-9H2,1-2H3 |
| InChIKey | DQHPTRPLGZRYGO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.65 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|