C13H18Br2ClN — CID 79452865
4-[2,2-bis(bromomethyl)-4-methylpentyl]-3-chloropyridine (PubChem CID 79452865) has the molecular formula C13H18Br2ClN and a molecular weight of 383.56 g/mol. Its IUPAC name is 4-[2,2-bis(bromomethyl)-4-methylpentyl]-3-chloropyridine.
| Compound Name | 4-[2,2-bis(bromomethyl)-4-methylpentyl]-3-chloropyridine |
|---|---|
| PubChem CID | 79452865 |
| Molecular Formula | C13H18Br2ClN |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 380.95 |
| IUPAC Name | 4-[2,2-bis(bromomethyl)-4-methylpentyl]-3-chloropyridine |
| SMILES | CC(C)CC(CBr)(CBr)Cc1ccncc1Cl |
| InChI | InChI=1S/C13H18Br2ClN/c1-10(2)5-13(8-14,9-15)6-11-3-4-17-7-12(11)16/h3-4,7,10H,5-6,8-9H2,1-2H3 |
| InChIKey | FBCHBSFKLKIXJS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|