C11H16BrClN2 — CID 80671408
N-(2-bromoethyl)-N-[(3-chloro-4-pyridinyl)methyl]propan-2-amine (PubChem CID 80671408) has the molecular formula C11H16BrClN2 and a molecular weight of 291.62 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(3-chloro-4-pyridinyl)methyl]propan-2-amine.
| Compound Name | N-(2-bromoethyl)-N-[(3-chloro-4-pyridinyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 80671408 |
| Molecular Formula | C11H16BrClN2 |
| Molecular Weight | 291.62 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | N-(2-bromoethyl)-N-[(3-chloro-4-pyridinyl)methyl]propan-2-amine |
| SMILES | CC(C)N(CCBr)Cc1ccncc1Cl |
| InChI | InChI=1S/C11H16BrClN2/c1-9(2)15(6-4-12)8-10-3-5-14-7-11(10)13/h3,5,7,9H,4,6,8H2,1-2H3 |
| InChIKey | HTNZROISYGVFGN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.62 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|