C16H20Br2S — CID 79452695
3-[2,2-bis(bromomethyl)-4-methylpentyl]-1-benzothiophene (PubChem CID 79452695) has the molecular formula C16H20Br2S and a molecular weight of 404.21 g/mol. Its IUPAC name is 3-[2,2-bis(bromomethyl)-4-methylpentyl]-1-benzothiophene.
| Compound Name | 3-[2,2-bis(bromomethyl)-4-methylpentyl]-1-benzothiophene |
|---|---|
| PubChem CID | 79452695 |
| Molecular Formula | C16H20Br2S |
| Molecular Weight | 404.21 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | 3-[2,2-bis(bromomethyl)-4-methylpentyl]-1-benzothiophene |
| SMILES | CC(C)CC(CBr)(CBr)Cc1csc2ccccc12 |
| InChI | InChI=1S/C16H20Br2S/c1-12(2)7-16(10-17,11-18)8-13-9-19-15-6-4-3-5-14(13)15/h3-6,9,12H,7-8,10-11H2,1-2H3 |
| InChIKey | WXEQTQILXIDTHE-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.21 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|