C14H14BrCl2NS — CID 79453857
5-[2-(2-bromophenyl)-3-chloro-2-(chloromethyl)propyl]-2-methyl-1,3-thiazole (PubChem CID 79453857) has the molecular formula C14H14BrCl2NS and a molecular weight of 379.15 g/mol. Its IUPAC name is 5-[2-(2-bromophenyl)-3-chloro-2-(chloromethyl)propyl]-2-methyl-1,3-thiazole.
| Compound Name | 5-[2-(2-bromophenyl)-3-chloro-2-(chloromethyl)propyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 79453857 |
| Molecular Formula | C14H14BrCl2NS |
| Molecular Weight | 379.15 g/mol |
| Exact Mass | 376.94 |
| IUPAC Name | 5-[2-(2-bromophenyl)-3-chloro-2-(chloromethyl)propyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1ncc(CC(CCl)(CCl)c2ccccc2Br)s1 |
| InChI | InChI=1S/C14H14BrCl2NS/c1-10-18-7-11(19-10)6-14(8-16,9-17)12-4-2-3-5-13(12)15/h2-5,7H,6,8-9H2,1H3 |
| InChIKey | VOPYFHSCCZLBAP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.15 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|