C9H13N3O6 — CID 79457797
2-[2-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]ethoxy]acetic acid (PubChem CID 79457797) has the molecular formula C9H13N3O6 and a molecular weight of 259.22 g/mol. Its IUPAC name is 2-[2-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]ethoxy]acetic acid.
| Compound Name | 2-[2-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 79457797 |
| Molecular Formula | C9H13N3O6 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-[2-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]ethoxy]acetic acid |
| SMILES | O=C(O)COCCNC(=O)CN1C(=O)CNC1=O |
| InChI | InChI=1S/C9H13N3O6/c13-6(10-1-2-18-5-8(15)16)4-12-7(14)3-11-9(12)17/h1-5H2,(H,10,13)(H,11,17)(H,15,16) |
| InChIKey | PUWLZVYZEGFJKL-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|