C15H22F2N2O — CID 79458545
1-N-[1-[3-(difluoromethoxy)phenyl]ethyl]cyclohexane-1,3-diamine (PubChem CID 79458545) has the molecular formula C15H22F2N2O and a molecular weight of 284.35 g/mol. Its IUPAC name is 1-N-[1-[3-(difluoromethoxy)phenyl]ethyl]cyclohexane-1,3-diamine.
| Compound Name | 1-N-[1-[3-(difluoromethoxy)phenyl]ethyl]cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 79458545 |
| Molecular Formula | C15H22F2N2O |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 1-N-[1-[3-(difluoromethoxy)phenyl]ethyl]cyclohexane-1,3-diamine |
| SMILES | CC(NC1CCCC(N)C1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C15H22F2N2O/c1-10(19-13-6-3-5-12(18)9-13)11-4-2-7-14(8-11)20-15(16)17/h2,4,7-8,10,12-13,15,19H,3,5-6,9,18H2,1H3 |
| InChIKey | HFQGYZLRWPQFQM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |