C14H18N2O2S — CID 79471397
ethyl 2-ethyl-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)butanoate (PubChem CID 79471397) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is ethyl 2-ethyl-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)butanoate.
| Compound Name | ethyl 2-ethyl-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)butanoate |
|---|---|
| PubChem CID | 79471397 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | ethyl 2-ethyl-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)butanoate |
| SMILES | CCOC(=O)C(CC)(CC)c1nc2cccnc2s1 |
| InChI | InChI=1S/C14H18N2O2S/c1-4-14(5-2,13(17)18-6-3)12-16-10-8-7-9-15-11(10)19-12/h7-9H,4-6H2,1-3H3 |
| InChIKey | OEZGNNSKKCXVOD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |