About ethyl 2-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)butanoate
ethyl 2-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)butanoate (PubChem CID 79471998) has the molecular formula C11H14N4O2
and a molecular weight of 234.26 g/mol. Its IUPAC name is ethyl 2-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)butanoate.
Molecular Properties
| Compound Name | ethyl 2-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)butanoate |
| PubChem CID | 79471998 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | ethyl 2-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)butanoate |
| SMILES | CCOC(=O)C(CC)c1nnc2cnccn12 |
| InChI | InChI=1S/C11H14N4O2/c1-3-8(11(16)17-4-2)10-14-13-9-7-12-5-6-15(9)10/h5-8H,3-4H2,1-2H3 |
| InChIKey | NIJMUYFLGFKXLW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)butanoate?
The IUPAC name of ethyl 2-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)butanoate (CID 79471998) is ethyl 2-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)butanoate.
What is the SMILES notation for ethyl 2-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)butanoate?
The canonical SMILES for ethyl 2-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)butanoate is CCOC(=O)C(CC)c1nnc2cnccn12.
What is the InChIKey of ethyl 2-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)butanoate?
The InChIKey is NIJMUYFLGFKXLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2/c1-3-8(11(16)17-4-2)10-14-13-9-7-12-5-6-15(9)10/h5-8H,3-4H2,1-2H3.
What are the key properties of ethyl 2-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)butanoate?
ethyl 2-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)butanoate has a molecular weight of 234.26 g/mol, XLogP of 1.18, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)butanoate is sourced from PubChem (CID 79471998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).