C16H21N3O2 — CID 79487086
2-(1-amino-2,2-dimethylpropyl)-5-(3-methylphenyl)-1H-pyrimidine-4,6-dione (PubChem CID 79487086) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-(1-amino-2,2-dimethylpropyl)-5-(3-methylphenyl)-1H-pyrimidine-4,6-dione.
| Compound Name | 2-(1-amino-2,2-dimethylpropyl)-5-(3-methylphenyl)-1H-pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 79487086 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-(1-amino-2,2-dimethylpropyl)-5-(3-methylphenyl)-1H-pyrimidine-4,6-dione |
| SMILES | Cc1cccc(C2C(=O)N=C(C(N)C(C)(C)C)NC2=O)c1 |
| InChI | InChI=1S/C16H21N3O2/c1-9-6-5-7-10(8-9)11-14(20)18-13(19-15(11)21)12(17)16(2,3)4/h5-8,11-12H,17H2,1-4H3,(H,18,19,20,21) |
| InChIKey | FVSALNBTGFQHEE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|