C14H23BrClNO2S2 — CID 79488410
2-bromo-5-(chloromethyl)-N-(2-methylpropyl)-N-pentan-3-ylthiophene-3-sulfonamide (PubChem CID 79488410) has the molecular formula C14H23BrClNO2S2 and a molecular weight of 416.83 g/mol. Its IUPAC name is 2-bromo-5-(chloromethyl)-N-(2-methylpropyl)-N-pentan-3-ylthiophene-3-sulfonamide.
| Compound Name | 2-bromo-5-(chloromethyl)-N-(2-methylpropyl)-N-pentan-3-ylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 79488410 |
| Molecular Formula | C14H23BrClNO2S2 |
| Molecular Weight | 416.83 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | 2-bromo-5-(chloromethyl)-N-(2-methylpropyl)-N-pentan-3-ylthiophene-3-sulfonamide |
| SMILES | CCC(CC)N(CC(C)C)S(=O)(=O)c1cc(CCl)sc1Br |
| InChI | InChI=1S/C14H23BrClNO2S2/c1-5-11(6-2)17(9-10(3)4)21(18,19)13-7-12(8-16)20-14(13)15/h7,10-11H,5-6,8-9H2,1-4H3 |
| InChIKey | MIIXTVVYBGICTM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.83 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|