C15H32N2O2 — CID 79489528
2-amino-2-methyl-4-[2-methylpropyl(pentan-3-yl)amino]pentanoic acid (PubChem CID 79489528) has the molecular formula C15H32N2O2 and a molecular weight of 272.43 g/mol. Its IUPAC name is 2-amino-2-methyl-4-[2-methylpropyl(pentan-3-yl)amino]pentanoic acid.
| Compound Name | 2-amino-2-methyl-4-[2-methylpropyl(pentan-3-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 79489528 |
| Molecular Formula | C15H32N2O2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | 2-amino-2-methyl-4-[2-methylpropyl(pentan-3-yl)amino]pentanoic acid |
| SMILES | CCC(CC)N(CC(C)C)C(C)CC(C)(N)C(=O)O |
| InChI | InChI=1S/C15H32N2O2/c1-7-13(8-2)17(10-11(3)4)12(5)9-15(6,16)14(18)19/h11-13H,7-10,16H2,1-6H3,(H,18,19) |
| InChIKey | CBFOJNCAKXRXTE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |