C13H27NO2 — CID 152728228
2-amino-5-ethyl-2,8-dimethylnonanoic acid (PubChem CID 152728228) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 2-amino-5-ethyl-2,8-dimethylnonanoic acid.
| Compound Name | 2-amino-5-ethyl-2,8-dimethylnonanoic acid |
|---|---|
| PubChem CID | 152728228 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 2-amino-5-ethyl-2,8-dimethylnonanoic acid |
| SMILES | CCC(CCC(C)C)CCC(C)(N)C(=O)O |
| InChI | InChI=1S/C13H27NO2/c1-5-11(7-6-10(2)3)8-9-13(4,14)12(15)16/h10-11H,5-9,14H2,1-4H3,(H,15,16) |
| InChIKey | ZXBBEKCLFDNNMT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |