C11H9ClN2O3 — CID 79492078
3-chloro-4-hydroxy-N-(1,2-oxazol-3-ylmethyl)benzamide (PubChem CID 79492078) has the molecular formula C11H9ClN2O3 and a molecular weight of 252.66 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-(1,2-oxazol-3-ylmethyl)benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-(1,2-oxazol-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 79492078 |
| Molecular Formula | C11H9ClN2O3 |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 3-chloro-4-hydroxy-N-(1,2-oxazol-3-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccon1)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C11H9ClN2O3/c12-9-5-7(1-2-10(9)15)11(16)13-6-8-3-4-17-14-8/h1-5,15H,6H2,(H,13,16) |
| InChIKey | WBTQECMZOIWFIQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |