C11H10N2O4 — CID 103721251
2,4-dihydroxy-N-(1,2-oxazol-3-ylmethyl)benzamide (PubChem CID 103721251) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is 2,4-dihydroxy-N-(1,2-oxazol-3-ylmethyl)benzamide.
| Compound Name | 2,4-dihydroxy-N-(1,2-oxazol-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 103721251 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 2,4-dihydroxy-N-(1,2-oxazol-3-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccon1)c1ccc(O)cc1O |
| InChI | InChI=1S/C11H10N2O4/c14-8-1-2-9(10(15)5-8)11(16)12-6-7-3-4-17-13-7/h1-5,14-15H,6H2,(H,12,16) |
| InChIKey | IKJGMNHKEUIVAI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |