C11H7ClF2N2O2 — CID 86783353
3-chloro-2,4-difluoro-N-(1,2-oxazol-3-ylmethyl)benzamide (PubChem CID 86783353) has the molecular formula C11H7ClF2N2O2 and a molecular weight of 272.64 g/mol. Its IUPAC name is 3-chloro-2,4-difluoro-N-(1,2-oxazol-3-ylmethyl)benzamide.
| Compound Name | 3-chloro-2,4-difluoro-N-(1,2-oxazol-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 86783353 |
| Molecular Formula | C11H7ClF2N2O2 |
| Molecular Weight | 272.64 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 3-chloro-2,4-difluoro-N-(1,2-oxazol-3-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccon1)c1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C11H7ClF2N2O2/c12-9-8(13)2-1-7(10(9)14)11(17)15-5-6-3-4-18-16-6/h1-4H,5H2,(H,15,17) |
| InChIKey | WMUNXFIPYTYDIT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.64 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|