C11H9F2N3O2 — CID 81170611
3-amino-2,6-difluoro-N-(1,2-oxazol-3-ylmethyl)benzamide (PubChem CID 81170611) has the molecular formula C11H9F2N3O2 and a molecular weight of 253.21 g/mol. Its IUPAC name is 3-amino-2,6-difluoro-N-(1,2-oxazol-3-ylmethyl)benzamide.
| Compound Name | 3-amino-2,6-difluoro-N-(1,2-oxazol-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 81170611 |
| Molecular Formula | C11H9F2N3O2 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 3-amino-2,6-difluoro-N-(1,2-oxazol-3-ylmethyl)benzamide |
| SMILES | Nc1ccc(F)c(C(=O)NCc2ccon2)c1F |
| InChI | InChI=1S/C11H9F2N3O2/c12-7-1-2-8(14)10(13)9(7)11(17)15-5-6-3-4-18-16-6/h1-4H,5,14H2,(H,15,17) |
| InChIKey | VJRQKXMSAWSDTL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|