C11H18BrNO2S — CID 79494993
3-(4-bromothiophen-2-yl)-1,1-diethoxypropan-2-amine (PubChem CID 79494993) has the molecular formula C11H18BrNO2S and a molecular weight of 308.24 g/mol. Its IUPAC name is 3-(4-bromothiophen-2-yl)-1,1-diethoxypropan-2-amine.
| Compound Name | 3-(4-bromothiophen-2-yl)-1,1-diethoxypropan-2-amine |
|---|---|
| PubChem CID | 79494993 |
| Molecular Formula | C11H18BrNO2S |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 3-(4-bromothiophen-2-yl)-1,1-diethoxypropan-2-amine |
| SMILES | CCOC(OCC)C(N)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C11H18BrNO2S/c1-3-14-11(15-4-2)10(13)6-9-5-8(12)7-16-9/h5,7,10-11H,3-4,6,13H2,1-2H3 |
| InChIKey | DWTLRQOGQMVJKN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|