C13H21BrO2S — CID 116752512
1-(4-bromothiophen-2-yl)-3-ethoxy-3-ethylpentan-2-ol (PubChem CID 116752512) has the molecular formula C13H21BrO2S and a molecular weight of 321.28 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-3-ethoxy-3-ethylpentan-2-ol.
| Compound Name | 1-(4-bromothiophen-2-yl)-3-ethoxy-3-ethylpentan-2-ol |
|---|---|
| PubChem CID | 116752512 |
| Molecular Formula | C13H21BrO2S |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-3-ethoxy-3-ethylpentan-2-ol |
| SMILES | CCOC(CC)(CC)C(O)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C13H21BrO2S/c1-4-13(5-2,16-6-3)12(15)8-11-7-10(14)9-17-11/h7,9,12,15H,4-6,8H2,1-3H3 |
| InChIKey | BWNGCMIKPCRIKB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |