C13H21BrOS — CID 115790391
1-(4-bromothiophen-2-yl)-4,5,5-trimethylhexan-2-ol (PubChem CID 115790391) has the molecular formula C13H21BrOS and a molecular weight of 305.28 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-4,5,5-trimethylhexan-2-ol.
| Compound Name | 1-(4-bromothiophen-2-yl)-4,5,5-trimethylhexan-2-ol |
|---|---|
| PubChem CID | 115790391 |
| Molecular Formula | C13H21BrOS |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-4,5,5-trimethylhexan-2-ol |
| SMILES | CC(CC(O)Cc1cc(Br)cs1)C(C)(C)C |
| InChI | InChI=1S/C13H21BrOS/c1-9(13(2,3)4)5-11(15)7-12-6-10(14)8-16-12/h6,8-9,11,15H,5,7H2,1-4H3 |
| InChIKey | HVKHUOZBTZKFSM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |