C9H13BrOS2 — CID 65130914
1-(4-bromothiophen-2-yl)-3-ethylsulfanylpropan-2-ol (PubChem CID 65130914) has the molecular formula C9H13BrOS2 and a molecular weight of 281.24 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-3-ethylsulfanylpropan-2-ol.
| Compound Name | 1-(4-bromothiophen-2-yl)-3-ethylsulfanylpropan-2-ol |
|---|---|
| PubChem CID | 65130914 |
| Molecular Formula | C9H13BrOS2 |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-3-ethylsulfanylpropan-2-ol |
| SMILES | CCSCC(O)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C9H13BrOS2/c1-2-12-6-8(11)4-9-3-7(10)5-13-9/h3,5,8,11H,2,4,6H2,1H3 |
| InChIKey | HBCYTAKEVIWKOI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |