C10H15BrOS2 — CID 65129830
1-(4-bromothiophen-2-yl)-3-propylsulfanylpropan-2-ol (PubChem CID 65129830) has the molecular formula C10H15BrOS2 and a molecular weight of 295.27 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-3-propylsulfanylpropan-2-ol.
| Compound Name | 1-(4-bromothiophen-2-yl)-3-propylsulfanylpropan-2-ol |
|---|---|
| PubChem CID | 65129830 |
| Molecular Formula | C10H15BrOS2 |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-3-propylsulfanylpropan-2-ol |
| SMILES | CCCSCC(O)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C10H15BrOS2/c1-2-3-13-7-9(12)5-10-4-8(11)6-14-10/h4,6,9,12H,2-3,5,7H2,1H3 |
| InChIKey | BUKOYSWEGYVKOG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|